Class 12 Chemistry - Chapter The Solid State NCERT Solutions | Silver crystallises in fcc lattice. If e

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

A cubic solid is made of two elements P and Q. Atoms of Q are at the corners of the cube and P at the body-centre. What is the formula of the compound? What are the coordination numbers of P and Q?

An element with molar mass 2.7 x 10^-2kg mol^-1 forms a cubic unit cell with edge length 405 pm. If its density is 2.7 x 10³ kg m^-3, what is the nature of the cubic unit cell?

Copper crystallises into a fcc lattice with edge length 3.61 x 10^-8cm. Show that the calculated density is in agreement with its measured value of 8.92 g cm^-3.

A compound is formed by two elements M and N. The element N forms ccp and atoms of M occupy 1/3^rd of tetrahedral voids. What is the formula of the compound?

Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.

(i) What is the length of the side of the unit cell?

(ii) How many unit cells are there in 1.00 cm3of aluminium?

Analysis shows that nickel oxide has the formula Ni_0.98 O_1.00. What fractions of nickel exist as Ni²⁺and Ni³⁺ions?

Distinguish between

(i)Hexagonal and monoclinic unit cells

(ii) Face-centred and end-centred unit cells.

Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?

Ionic solids, which have anionic vacancies due to metal excess defect, develop colour. Explain with the help of a suitable example.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.

(i) Methanal                       (ii) 2-Methylpentanal

(iii) Benzaldehyde              (iv) Benzophenone

(v) Cyclohexanone             (vi) 1-Phenylpropanone

(vii) Phenylacetaldehyde     (viii) Butan-1-ol

(ix) 2, 2-Dimethylbutanal

Why is helium used in diving apparatus?

Complete the following reactions:

(i) C₂H₄ + O₂ →

(ii) 4Al + 3O₂ →

Arrange the following metals in the order in which they displace each other from the solution of their salts.

Al, Cu, Fe, Mg and Zn

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

What are the main constituents of dettol?

Calculate the osmotic pressure in pascals exerted by a solution prepared by dissolving 1.0 g of polymer of molar mass 185,000 in 450 mL of water at 37°C.

H₂S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H₂S in water at STP is 0.195 m, calculate Henry's law constant.

What are food preservatives ?

Complete each synthesis by giving missing starting material, reagent or products

(i)

(ii)

(iii)

(iv)

(v)

(vi)