Class 12 Chemistry - Chapter The p-Block Elements NCERT Solutions | Why is N2 less reactive at room temperat

Why is helium used in diving apparatus?

Why are pentahalides more covalent than trihalides?

Give the formula and describe the structure of a noble gas species which is isostructural with:

(i) ICl^-₄

(ii) IBr^-₂

(iii) BrO^-₃

Why is H₂O a liquid and H₂S a gas?

How is O₃ estimated quantitatively?

What happens when sulphur dioxide is passed through an aqueous solution of Fe(III) salt?

Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?

Why are halogens strong oxidising agents?

Arrange the following in the order of property indicated for each set:

(i) F₂, Cl₂, Br₂, I₂- increasing bond dissociation enthalpy.

(ii) HF, HCl, HBr, HI - increasing acid strength.

(iii) NH₃, PH₃, AsH₃, SbH₃, BiH₃- increasing base strength.

Comment on the nature of two S-O bonds formed in SO₂ molecule. Are the two S-O bonds in this molecule equal?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Write the equations for the preparation of 1-iodobutane from

(i) 1-butanol

(ii) 1-chlorobutane

(iii) but-1-ene.

Enumerate the reactions of D-glucose which cannot be explained by its open chain structure.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

What happens when

(i) n-butyl chloride is treated with alcoholic KOH,

(ii) bromobenzene is treated with Mg in the presence of dry ether,

(iii) chlorobenzene is subjected to hydrolysis,

(iv) ethyl chloride is treated with aqueous KOH,

(v) methyl bromide is treated with sodium in the presence of dry ether,

(vi) methyl chloride is treated with KCN.

Write the structure of the major organic product in each of the following reactions:

Which alkyl halide from the following pairs would you expect to react more rapidly by an S_N2 mechanism? Explain your answer.

How much electricity in terms of Faraday is required to produce

(i) 20.0 g of Ca from molten CaCl₂.

(ii) 40.0 g of Al from molten Al₂O₃.

Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?

Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.

(i) Methanal                       (ii) 2-Methylpentanal

(iii) Benzaldehyde              (iv) Benzophenone

(v) Cyclohexanone             (vi) 1-Phenylpropanone

(vii) Phenylacetaldehyde     (viii) Butan-1-ol

(ix) 2, 2-Dimethylbutanal

What are monosaccharides?