Class 12 Chemistry - Chapter The p-Block Elements NCERT Solutions | How can you prepare Cl2 from HCl and HCl

Why is helium used in diving apparatus?

Why are pentahalides more covalent than trihalides?

Give the formula and describe the structure of a noble gas species which is isostructural with:

(i) ICl^-₄

(ii) IBr^-₂

(iii) BrO^-₃

Why is H₂O a liquid and H₂S a gas?

How is O₃ estimated quantitatively?

What happens when sulphur dioxide is passed through an aqueous solution of Fe(III) salt?

Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?

Why are halogens strong oxidising agents?

Arrange the following in the order of property indicated for each set:

(i) F₂, Cl₂, Br₂, I₂- increasing bond dissociation enthalpy.

(ii) HF, HCl, HBr, HI - increasing acid strength.

(iii) NH₃, PH₃, AsH₃, SbH₃, BiH₃- increasing base strength.

Comment on the nature of two S-O bonds formed in SO₂ molecule. Are the two S-O bonds in this molecule equal?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Write the monomers used for getting the following polymers. (i) Polyvinyl chloride (ii) Teflon (iii) Bakelite

Action of soap is due to emulsification and micelle formation. Comment.

How many geometrical isomers are possible in the following coordination entities?

(i) [Cr(C₂O₄)₃]^3-

(ii) [Co(NH₃)₃Cl₃]

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Why do we require artificial sweetening agents?

What problem arises in using alitame as artificial sweetener?

How will you convert ethanal into the following compounds?

(i) Butane-1, 3-diol  (ii) But-2-enal  (iii) But-2-enoic acid

Describe the oxidising action of potassium dichromate and write the ionicequations for its reaction with:

(i) iodide

(ii) iron

(II) solution and

(iii) H₂S

Arrange the compounds of each set in order of reactivity towards SN2 displacement:

(i) 2-Bromo-2-methylbutane, 1-Bromopentane, 2-Bromopentane

(ii) 1-Bromo-3-methylbutane, 2-Bromo-2-methylbutane, 3-Bromo-2- methylbutane

(iii) 1-Bromobutane, 1-Bromo-2,2-dimethylpropane, 1-Bromo-2-methylbutane, 1-Bromo-3-methylbutane.

How would you determine the standard electrode potential of the system Mg²⁺ | Mg?