Class 12 Chemistry - Chapter The d-and f-Block Elements NCERT Solutions | What is lanthanoid contraction? What are

Explain why Cu⁺ ion is not stable in aqueous solutions?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

The E^θ(M²⁺/M) value for copper is positive (+0.34V). What is possibly the reason for this? (Hint: consider its high Δ_aHV and low Δ_hydHV)

How would you account for the following:

(i) Of the d⁴ species, Cr²⁺ is strongly reducing while manganese (III) is strongly oxidising.

(ii) Cobalt (II) is stable in aqueous solution but in the presence of complexing reagents it is easily oxidised.

(iii) The d¹ configuration is very unstable in ions.

Actinoid contraction is greater from element to element than lanthanoid contraction. Why?

Which is a stronger reducing agent Cr²⁺ or Fe²⁺ and why?

Explain giving reasons:

(i) Transition metals and many of their compounds show paramagnetic behaviour.

(ii) The enthalpies of atomisation of the transition metals are high.

(iii) The transition metals generally form coloured compounds.

(iv) Transition metals and their many compounds act as good catalyst.

Give examples and suggest reasons for the following features of the transition metal chemistry:

(i)The lowest oxide of transition metal is basic, the highest is amphoteric/acidic.

(ii)A transition metal exhibits highest oxidation state in oxides and fluorides.

(iii) The highest oxidation state is exhibited in oxoanions of a metal.

Predict which of the following will be coloured in aqueous solution?

Ti³⁺, V³⁺, Cu⁺, Sc³⁺, Mn²⁺, Fe³⁺ and Co²⁺.

Give reasons for each.

Describe the preparation of potassium dichromate from iron chromite ore. What is the effect of increasing pH on a solution of potassium dichromate?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Two elements A and B form compounds having formula AB₂ and AB₄. When dissolved in 20 g of benzene (C₆H₆), 1 g of AB₂ lowers the freezing point by 2.3 Kwhereas 1.0 g of AB₄ lowers it by 1.3 K. The molar depression constant for benzene is 5.1 Kkg mol^-1. Calculate atomic masses of A and B.

Give plausible explanation for each of the following:

(i) Cyclohexanone forms cyanohydrin in good yield but 2, 2, 6 trimethylcyclohexanone does not.

(ii) There are two -NH₂ groups in semicarbazide. However, only one is involved in the formation of semicarbazones.

(iii) During the preparation of esters from a carboxylic acid and an alcohol in the presence of an acid catalyst, the water or the ester should be removed as soon as it is formed.

What is meant by the chelate effect? Give an example.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Show how each of the following compounds can be converted to benzoic acid.

(i) Ethylbenzene        (ii) Acetophenone

(iii) Bromobenzene    (iv) Phenylethene (Styrene)

Write the equations for the preparation of 1-iodobutane from

(i) 1-butanol

(ii) 1-chlorobutane

(iii) but-1-ene.

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

(i) Draw the structures of all isomeric alcohols of molecular formula C₅H₁₂O and give their IUPAC names.

(ii) Classify the isomers of alcohols in question 11.3 (i) as primary, secondary and tertiary alcohols.