Class 12 Chemistry - Chapter Surface Chemistry NCERT Solutions | Why does physisorption decrease with the

Explain what is observed

(i) When a beam of light is passed through a colloidal sol.

(ii) An electrolyte, NaCl is added to hydrated ferric oxide sol.

(iii) Electric current is passed through a colloidal sol?

Why is adsorption always exothermic?

What do you mean by activity and selectivity of catalysts?

What modification can you suggest in the Hardy-Schulze law?

Explain the following terms:

(i) Electrophoresis

(ii) Coagulation

(iii) Dialysis

(iv) Tyndall effect.

What is an adsorption isotherm? Describe Freundlich adsorption isotherm.

Explain the terms with suitable examples:

(i) Alcosol

(ii) Aerosol

(iii) Hydrosol

How are colloids classified on the basis of

(i) Physical states of components

(ii) Nature of dispersion medium and

(iii) Interaction between dispersed phase and dispersion medium?

Discuss the effect of pressure and temperature on the adsorption of gases on solids.

What are the factors which influence the adsorption of a gas on a solid?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Given the standard electrode potentials,

K⁺/ K = - 2.93V, 

Ag⁺/ Ag = 0.80V,

Hg²⁺ / Hg = 0.79V

Mg²⁺ / Mg = - 2.37 V,

Cr³⁺ / Cr = - 0.74V

Arrange these metals in their increasing order of reducing power.

Name two poisonous gases which can be prepared from chlorine gas.

Amongst the following, the most stable complex is

(i) [Fe(H₂O)₆]³⁺

(ii) [Fe(NH₃)₆]³⁺

(iii) [Fe(C₂O₄)₃]^3-

(iv) [FeCl₆]^3-

Why is N2 less reactive at room temperature?

Write the equations for the preparation of 1-iodobutane from

(i) 1-butanol

(ii) 1-chlorobutane

(iii) but-1-ene.

Enumerate the reactions of D-glucose which cannot be explained by its open chain structure.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Give the resonating structures of NO₂ and N₂O₅.

What happens when

(i) n-butyl chloride is treated with alcoholic KOH,

(ii) bromobenzene is treated with Mg in the presence of dry ether,

(iii) chlorobenzene is subjected to hydrolysis,

(iv) ethyl chloride is treated with aqueous KOH,

(v) methyl bromide is treated with sodium in the presence of dry ether,

(vi) methyl chloride is treated with KCN.

Write the structure of the major organic product in each of the following reactions: