Class 12 Chemistry - Chapter Surface Chemistry NCERT Solutions | What is demulsification? Name two demuls

Explain what is observed

(i) When a beam of light is passed through a colloidal sol.

(ii) An electrolyte, NaCl is added to hydrated ferric oxide sol.

(iii) Electric current is passed through a colloidal sol?

Why is adsorption always exothermic?

What do you mean by activity and selectivity of catalysts?

What modification can you suggest in the Hardy-Schulze law?

Explain the following terms:

(i) Electrophoresis

(ii) Coagulation

(iii) Dialysis

(iv) Tyndall effect.

What is an adsorption isotherm? Describe Freundlich adsorption isotherm.

Explain the terms with suitable examples:

(i) Alcosol

(ii) Aerosol

(iii) Hydrosol

How are colloids classified on the basis of

(i) Physical states of components

(ii) Nature of dispersion medium and

(iii) Interaction between dispersed phase and dispersion medium?

Discuss the effect of pressure and temperature on the adsorption of gases on solids.

Why does physisorption decrease with the increase of temperature

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

What happens when

(i) n-butyl chloride is treated with alcoholic KOH,

(ii) bromobenzene is treated with Mg in the presence of dry ether,

(iii) chlorobenzene is subjected to hydrolysis,

(iv) ethyl chloride is treated with aqueous KOH,

(v) methyl bromide is treated with sodium in the presence of dry ether,

(vi) methyl chloride is treated with KCN.

What is lanthanoid contraction? What are the consequences of lanthanoid contraction?

Two elements A and B form compounds having formula AB₂ and AB₄. When dissolved in 20 g of benzene (C₆H₆), 1 g of AB₂ lowers the freezing point by 2.3 Kwhereas 1.0 g of AB₄ lowers it by 1.3 K. The molar depression constant for benzene is 5.1 Kkg mol^-1. Calculate atomic masses of A and B.

Give plausible explanation for each of the following:

(i) Cyclohexanone forms cyanohydrin in good yield but 2, 2, 6 trimethylcyclohexanone does not.

(ii) There are two -NH₂ groups in semicarbazide. However, only one is involved in the formation of semicarbazones.

(iii) During the preparation of esters from a carboxylic acid and an alcohol in the presence of an acid catalyst, the water or the ester should be removed as soon as it is formed.

What is meant by the chelate effect? Give an example.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Show how each of the following compounds can be converted to benzoic acid.

(i) Ethylbenzene        (ii) Acetophenone

(iii) Bromobenzene    (iv) Phenylethene (Styrene)

Write the equations for the preparation of 1-iodobutane from

(i) 1-butanol

(ii) 1-chlorobutane

(iii) but-1-ene.

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.