Amongst the following compounds, identify which are insoluble, partially soluble and highly soluble in water?
(i) phenol (ii) toluene (iii) formic acid (iv) ethylene glycol (v) chloroform (vi) pentanol.
(i) Phenol (C6H5OH) has the polar group -OH and non-polar group -C6H5. Thus, phenol is partially soluble in water.
(ii) Toluene (C6H5-CH3) has no polar groups. Thus, toluene is insoluble in water.
(iii) Formic acid (HCOOH) has the polar group -OH and can form H-bond with water. Thus, formic acid is highly soluble in water.
(iv) Ethylene glycol has polar -OH group and can form H-bond. Thus, it is highly soluble in water.
(v) Chloroform is insoluble in water.
(vi) Pentanol (C5H11OH) has polar -OH group, but it also contains a very bulky non-polar -C5H11 group. Thus, pentanol is partially soluble in water.
A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.
A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL-1, then what shall be the molarity of the solution?
Henry's law constant for CO2 in water is 1.67 x 108Pa at 298 K. Calculate the quantity of CO2in 500 mL of soda water when packed under 2.5 atm CO2 pressure at 298 K.
Calculate the mass of a non-volatile solute (molar mass 40 g mol-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.
The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.
Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.
How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na2CO3 and NaHCO3 containing equimolar amounts of both?
H2S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H2S in water at STP is 0.195 m, calculate Henry's law constant.
An aqueous solution of 2% non-volatile solute exerts a pressure of 1.004 bar at the normal boiling point of the solvent. What is the molar mass of the solute?
Boiling point of water at 750 mm Hg is 99.63°C. How much sucrose is to be added to 500 g of water such that it boils at 100°C.Molal elevation constant for water is 0.52 K kg mol-1.
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
(i) Draw the structures of all isomeric alcohols of molecular formula C5H12O and give their IUPAC names.
(ii) Classify the isomers of alcohols in question 11.3 (i) as primary, secondary and tertiary alcohols.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?
While antacids and anti allergic drugs interfere with the function of histamines, why do these not interfere with the function of each other ?
Calculate the standard cell potentials of galvanic cells in which the following reactions take place:
(i) 2Cr(s) + 3Cd2+(aq) → 2Cr3+(aq) + 3Cd
(ii) Fe2+(aq) + Ag+(aq) → Fe3+(aq) + Ag(s)
Calculate the ΔrGø¸ and equilibrium constant of the reactions.
Why is glass considered a super cooled liquid?
Name the oxometal anions of the first series of the transition metals in which the metal exhibits the oxidation state equal to its group number.
Comment on the nature of two S-O bonds formed in SO2 molecule. Are the two S-O bonds in this molecule equal?
Explain why NH3 is basic while BiH3 is only feebly basic.
Why cannot aromatic primary amines be prepared by Gabriel phthalimide synthesis?
Explain briefly