Class 12 Chemistry - Chapter Solutions NCERT Solutions | An aqueous solution of 2% non-volatile s

A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

Calculate the mass of a non-volatile solute (molar mass 40 g mol^-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na₂CO₃ and NaHCO₃ containing equimolar amounts of both?

H₂S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H₂S in water at STP is 0.195 m, calculate Henry's law constant.

Boiling point of water at 750 mm Hg is 99.63°C. How much sucrose is to be added to 500 g of water such that it boils at 100°C.Molal elevation constant for water is 0.52 K kg mol^-1.

Vapour pressure of pure water at 298 K is 23.8 mm Hg. 50 g of urea (NH₂CONH₂) is dissolved in 850 g of water. Calculate the vapour pressure of water for this solution and its relative lowering.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Illustrate with examples the limitations of Williamson synthesis for the preparation of certain types of ethers.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

Write the reactions of Williamson synthesis of 2-ethoxy-3-methylpentane starting from ethanol and 3-methylpentan-2-ol.

Describe the manufacture of H₂SO₄ by contact process?

Classify the following as addition and condensation polymers: Terylene, Bakelite, Polyvinyl chloride, Polythene.

What can be inferred from the magnetic moment values of the following complex species?

Example Magnetic Moment (BM)

K₄[Mn(CN)₆] 2.2

[Fe(H₂O)₆]²⁺ 5.3

K₂[MnCl₄] 5.9

Write IUPAC names of the following compounds and classify them into primary,secondary and tertiary amines.

(i) (CH₃)₂ CHNH₂

(ii) CH₃(CH₂)₂NH₂

(iii) CH₃NHCH(CH₃)₂

(iv) (CH₃)₃CNH₂

(v) C₆H₅NHCH₃

(vi) (CH₃CH₂)₂NCH₃

(vii) m-BrC₆H₄NH₂

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.

Write all the geometrical isomers of [Pt(NH₃)(Br)(Cl)(py)] and how many of these will exhibit optical isomers?