Class 12 Chemistry - Chapter Polymers NCERT Solutions | Classify the following as addition and c

Write the names and structures of the monomers of the following polymers:

(i) Buna-S  (ii) Buna-N

(iii) Dacron  (iv) Neoprene

What is a biodegradable polymer? Give an example of a biodegradable aliphatic polyester.

Arrange the following polymers in increasing order of their intermolecular forces.
(i) Nylon 6, 6, Buna-S, Polythene.
(ii) Nylon 6, Neoprene, Polyvinyl chloride.

Explain the difference between Buna-N and Buna-S.

How are polymers classified on the basis of structure?

Define thermoplastics and thermosetting polymers with two examples of each.

Explain the term copolymerisation and give two examples.

Write the monomers used for getting the following polymers. (i) Polyvinyl chloride (ii) Teflon (iii) Bakelite

How do you explain the functionality of a monomer?

Identify the monomer in the following polymeric structures.

(i)

(ii)

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

What can be inferred from the magnetic moment values of the following complex species?

Example Magnetic Moment (BM)

K₄[Mn(CN)₆] 2.2

[Fe(H₂O)₆]²⁺ 5.3

K₂[MnCl₄] 5.9

Write IUPAC names of the following compounds and classify them into primary,secondary and tertiary amines.

(i) (CH₃)₂ CHNH₂

(ii) CH₃(CH₂)₂NH₂

(iii) CH₃NHCH(CH₃)₂

(iv) (CH₃)₃CNH₂

(v) C₆H₅NHCH₃

(vi) (CH₃CH₂)₂NCH₃

(vii) m-BrC₆H₄NH₂

A sample of drinking water was found to be severely contaminated with chloroform (CHCl₃) supposed to be a carcinogen. The level of contamination was 15 ppm (by mass):

(i) express this in percent by mass

(ii) determine the molality of chloroform in the water sample.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Illustrate with examples the limitations of Williamson synthesis for the preparation of certain types of ethers.

Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.

Write all the geometrical isomers of [Pt(NH₃)(Br)(Cl)(py)] and how many of these will exhibit optical isomers?

What are the characteristics of the transition elements and why are they called transition elements? Which of the d-block elements may not be regarded as the transition elements?

Sleeping pills are recommended by doctors to the patients suffering from sleeplessness but it is not advisable to take its doses without consultation with the doctor, Why?

Why copper matte is put in silica lined converter?