Define the term polymerisation.
Polymerization is the process of forming high molecular mass (103 - 107 u) macromolecules, which consist of repeating structural units derived from monomers. In a polymer, various monomer units are joined by strong covalent bonds.
Write the names and structures of the monomers of the following polymers:
(i) Buna-S (ii) Buna-N
(iii) Dacron (iv) Neoprene
What is a biodegradable polymer? Give an example of a biodegradable aliphatic polyester.
Arrange the following polymers in increasing order of their intermolecular forces.
(i) Nylon 6, 6, Buna-S, Polythene.
(ii) Nylon 6, Neoprene, Polyvinyl chloride.
Explain the difference between Buna-N and Buna-S.
How are polymers classified on the basis of structure?
Define thermoplastics and thermosetting polymers with two examples of each.
Explain the term copolymerisation and give two examples.
Write the monomers used for getting the following polymers. (i) Polyvinyl chloride (ii) Teflon (iii) Bakelite
How do you explain the functionality of a monomer?
Identify the monomer in the following polymeric structures.
(i)
(ii)
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Complete the following reactions:
(i)
(ii)
(iii)
(iv)
(v)
(vi)
(vii)
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Write balanced equations for the following:
(i) NaCl is heated with sulphuric acid in the presence of MnO2.
(ii) Chlorine gas is passed into a solution of NaI in water.
Write all the geometrical isomers of [Pt(NH3)(Br)(Cl)(py)] and how many of these will exhibit optical isomers?
Explain the following terms with suitable examples:
(i) Schottky defect
(ii) Frenkel defect
(iii) Interstitials and
(iv) F-centres
What is the effect of denaturation on the structure of proteins?
Give four uses of emulsions.
How are the following conversions carried out?
(i) Propene → Propan-2-ol
(ii) Benzyl chloride → Benzyl alcohol
(iii) Ethyl magnesium chloride → Propan-1-ol.
(iv) Methyl magnesium bromide → 2-Methylpropan-2-ol.
Depict the galvanic cell in which the reaction Zn(s) + 2Ag+(aq) → Zn2+(aq) + 2Ag(s) takes place.
Further show:
(i) Which of the electrode is negatively charged?
(ii) The carriers of the current in the cell.
(iii) Individual reaction at each electrode.
What is spectrochemical series? Explain the difference between a weak field ligand and a strong field ligand.