Differentiate between "minerals" and "ores".
Minerals are naturally occurring chemical substances containing metals. They are found in the Earth's crust and are obtained by mining.
Ores are rocks and minerals viable to be used as a source of metal.
For example, there are many minerals containing zinc, but zinc cannot be extracted profitably (conveniently and economically) from all these minerals. Zinc can be obtained from zinc blende (ZnS), calamine (ZnCO3), Zincite (ZnO) etc.
Thus, these minerals are called ores of zinc.
What is the significance of leaching in the extraction of aluminium?
Write down the reactions taking place in different zones in the blast furnace during the extraction of iron.
Copper can be extracted by hydrometallurgy but not zinc. Explain.
Outline the principles of refining of metals by the following methods:
(i) Zone refining
(ii) Electrolytic refining
(iii) Vapour phase refining
Name the common elements present in the anode mud in electrolytic refining of copper. Why are they so present ?
The reaction,
Cr2O3 + 2Al → Al2O3 + 2Cr (ΔGo = -421kJ)
is thermodynamically feasible as is apparent from the Gibbs energy value. Why does it not take place at room temperature?
How can you separate alumina from silica in bauxite ore associated with silica? Give equations, if any.
Why is the extraction of copper from pyrites more difficult than that from its oxide ore through reduction?
Write chemical reactions taking place in the extraction of zinc from zinc blende.
Describe a method for refining nickel.
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
Arrange the following compounds in increasing order of their boiling points.
CH3CHO, CH3CH2OH, CH3OCH3, CH3CH2CH3
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Write structural formulas and names of four possible aldol condensation products from propanal and butanal. In each case, indicate which aldehyde acts as nucleophile and which as electrophile.
Complete each synthesis by giving missing starting material, reagent or products
(i)
(ii)
(iii)
(iv)
(v)
(vi)
Although phenoxide ion has more number of resonating structures than carboxylate ion, carboxylic acid is a stronger acid than phenol. Why?
Calculate the osmotic pressure in pascals exerted by a solution prepared by dissolving 1.0 g of polymer of molar mass 185,000 in 450 mL of water at 37°C.
Write the structures of products of the following reactions;
(i)
(ii)
(iii)
(iv)
Predict the products of the following reactions:
(i)
(ii)
(iii)
(iv)
Give the IUPAC names of the following compounds:
(i) PhCH2CH2COOH (ii) (CH3)2C=CHCOOH
(iii) (iv)
What is meant by the following terms? Give an example of the reaction in each case.
(i) Cyanohydrin (ii) Acetal
(iii) Semicarbazone
(iv) Aldol
(v) Hemiacetal
(vi) Oxime
(vii) Ketal
(vii) Imine
(ix) 2,4-DNP-derivative
(x) Schiff's base
Give the extraction of copper from copper pyrite