Class 12 Chemistry - Chapter General Principles and Processes of Isolation of Elements NCERT Solutions | Name the processes from which chlorine i
Name the processes from which chlorine is obtained as a by-product. What will happen if an aqueous solution of NaCl is subjected to electrolysis?
In the electrolysis of molten NaCl, Cl2 is obtained at the anode as a by product.
NaCl(melt) → Na+(melt) + Cl-(melt)
At cathode: Na+(melt) + e- → Na(s)
At anode: Cl-(melt) → Cl(g) + e-
2Cl(g) → Cl2(g)
The overall reaction is as follows:
If an aqueous solution of NaCl is electrolyzed, Cl2 will be obtained at the anode but at the cathode, H2 will be obtained (instead of Na). This is because the standard reduction potential of Na (E°= - 2.71 V) is more negative than that of H2O (E° = - 0.83 V). Hence, H2O will get preference to get reduced at the cathode and as a result, H2 is evolved.
NaCl(aq) → Na+(aq) + Cl-(aq)
At cathode: 2 H2O(l) + 2e- → H2(g) + 2OH-(aq)
At anode: Cl-(melt) → Cl(g) + e-
2Cl(g) → Cl2(g)
More Questions From Class 12 Chemistry - Chapter General Principles and Processes of Isolation of Elements
- Q:-
What is the significance of leaching in the extraction of aluminium?
- Q:-
Write down the reactions taking place in different zones in the blast furnace during the extraction of iron.
- Q:-
Copper can be extracted by hydrometallurgy but not zinc. Explain.
- Q:-
Outline the principles of refining of metals by the following methods:
(i) Zone refining
(ii) Electrolytic refining
(iii) Vapour phase refining
- Q:-
Name the common elements present in the anode mud in electrolytic refining of copper. Why are they so present ?
- Q:-
The reaction,
Cr2O3 + 2Al → Al2O3 + 2Cr (ΔGo = -421kJ)
is thermodynamically feasible as is apparent from the Gibbs energy value. Why does it not take place at room temperature?
- Q:-
How can you separate alumina from silica in bauxite ore associated with silica? Give equations, if any.
- Q:-
Why is the extraction of copper from pyrites more difficult than that from its oxide ore through reduction?
- Q:-
Write chemical reactions taking place in the extraction of zinc from zinc blende.
- Q:-
Describe a method for refining nickel.
Popular Questions of Class 12 Chemistry
- Q:-
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
- Q:-
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
- Q:-
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
- Q:-
Why are solids rigid?
- Q:-
Write any two characteristics of Chemisorption.
- Q:-
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
- Q:-
Why are pentahalides more covalent than trihalides?
- Q:-
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
- Q:-
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
- Q:-
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
Recently Viewed Questions of Class 12 Chemistry
- Q:-
What type of bonding helps in stabilising the ∝-helix structure of proteins?
- Q:-
List the uses of Neon and argon gases.
- Q:-
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
- Q:-
A solution containing 30 g of non-volatile solute exactly in 90 g of water has a vapour pressure of 2.8 kPa at 298 K. Further, 18 g of water is then added to the solution and the new vapour pressure becomes 2.9 kPa at 298 K. Calculate:
1) Molar mass of the solute
2) Vapour pressure of water at 298 K.
- Q:-
Write any two characteristics of Chemisorption.
- Q:-
How will you distinguish between the following pairs of terms:
(i) Hexagonal close-packing and cubic close-packing?
(ii) Crystal lattice and unit cell?
(iii) Tetrahedral void and octahedral void?
- Q:-
When RNA is hydrolysed, there is no relationship among the quantities of different bases obtained. What does this fact suggest about the structure of RNA?
- Q:-
Which of the following is an appropriate set of reactants for the preparation of 1-methoxy-4-nitrobenzene and why?
- Q:-
The half-life for radioactive decay of 14C is 5730 years. An archaeological artifact containing wood had only 80% of the 14C found in a living tree. Estimate the age of the sample.
- Q:-
Arrange the following:
(i) In decreasing order of the pKbvalues:
C2H5NH2, C6H5NHCH3, (C2H5)2NH and C6H5NH2
(ii) In increasing order of basic strength:
C6H5NH2, C6H5N(CH3)2, (C2H5)2NH and CH3NH2
(iii) In increasing order of basic strength:
(a) Aniline, p-nitroaniline and p-toluidine
(b) C6H5NH2, C6H5NHCH3, C6H5CH2NH2.
(iv) In decreasing order of basic strength in gas phase:
C2H5NH2, (C2H5)2NH, (C2H5)3N and NH3
(v) In increasing order of boiling point:
C2H5OH, (CH3)2NH, C2H5NH2
(vi) In increasing order of solubility in water:
C6H5NH2, (C2H5)2NH, C2H5NH2.
1 Comment(s) on this Question
,ðððð
- All Chapters Of Class 12 Chemistry
- All Subjects Of Class 12