Class 12 Chemistry - Chapter Electrochemistry NCERT Solutions | Consider the reaction: Cr2 O72- + 14

If a current of 0.5 ampere flows through a metallic wire for 2 hours, then how many electrons would flow through the wire?

Calculate the emf of the cell in which the following reaction takes place:

Ni_(s) + 2Ag⁺ (0.002 M) → Ni²⁺ (0.160 M) + 2Ag_(s)

Given that E^ø_cell = 1.05 V

Depict the galvanic cell in which the reaction Zn(s) + 2Ag⁺(aq) → Zn²⁺(aq) + 2Ag(s) takes place.

Further show:

(i) Which of the electrode is negatively charged?

(ii) The carriers of the current in the cell.

(iii) Individual reaction at each electrode.

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.

Write the Nernst equation and emf of the following cells at 298 K:

(i) Mg(s) | Mg²⁺(0.001M) || Cu²⁺(0.0001 M) | Cu(s)

(ii) Fe(s) | Fe²⁺(0.001M) || H⁺(1M)|H₂(g)(1bar) | Pt(s)

(iii) Sn(s) | Sn²⁺(0.050 M) || H⁺(0.020 M) | H₂(g) (1 bar) | Pt(s)

(iv) Pt(s) | Br₂(l) | Br^-(0.010 M) || H⁺(0.030 M) | H₂(g) (1 bar) | Pt(s).

Define conductivity and molar conductivity for the solution of an electrolyte. Discuss their variation with concentration.

How would you determine the standard electrode potential of the system Mg²⁺ | Mg?

Predict the products of electrolysis in each of the following:

(i) An aqueous solution of AgNO₃ with silver electrodes.

(ii) An aqueous solution of AgNO₃with platinum electrodes.

(iii) A dilute solution of H₂SO₄with platinum electrodes.

(iv) An aqueous solution of CuCl₂ with platinum electrodes.

A solution of Ni(NO₃)₂ is electrolysed between platinum electrodes using a current of 5 amperes for 20 minutes. What mass of Ni is deposited at the cathode?

The resistance of a conductivity cell containing 0.001M KCl solution at 298 K is 1500 Ω. What is the cell constant if conductivity of 0.001M KCl solution at 298 K is 0.146 x 10^-3 S cm^-1.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

During nuclear explosion, one of the products is ⁹⁰Sr with half-life of 28.1 years. If 1μg of ⁹⁰Sr was absorbed in the bones of a newly born baby instead of calcium, how much of it will remain after 10 years and 60 years if it is not lost metabolically.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Explain the term copolymerisation and give two examples.

What are micelles? Give an example of a micellers system.

Refractive index of a solid is observed to have the same value along all directions. Comment on the nature of this solid. Would it show cleavage property?

Aluminium crystallises in a cubic close-packed structure. Its metallic radius is 125 pm.

(i) What is the length of the side of the unit cell?

(ii) How many unit cells are there in 1.00 cm3of aluminium?

The decomposition of NH₃on platinum surface is zero order reaction. What are the rates of production of N₂and H₂if k = 2.5 x 10^-4mol^-1L s^-1?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Describe a method for refining nickel.