Given the standard electrode potentials,
K+/ K = - 2.93V,
Ag+/ Ag = 0.80V,
Hg2+ / Hg = 0.79V
Mg2+ / Mg = - 2.37 V,
Cr3+ / Cr = - 0.74V
Arrange these metals in their increasing order of reducing power.
The lower the reduction potential, the higher is the reducing power. The given standard electrode potentials increase in the order of
K+/ K < Mg2+ / Mg < Cr3+ / Cr < Hg2+ / Hg < Ag+ / Ag.
Hence, the reducing power of the given metals increases in the following order:
Ag < Hg < Cr < Mg < K
If a current of 0.5 ampere flows through a metallic wire for 2 hours, then how many electrons would flow through the wire?
Calculate the emf of the cell in which the following reaction takes place:
Ni(s) + 2Ag+ (0.002 M) → Ni2+ (0.160 M) + 2Ag(s)
Given that Eøcell = 1.05 V
Depict the galvanic cell in which the reaction Zn(s) + 2Ag+(aq) → Zn2+(aq) + 2Ag(s) takes place.
Further show:
(i) Which of the electrode is negatively charged?
(ii) The carriers of the current in the cell.
(iii) Individual reaction at each electrode.
Calculate the standard cell potentials of galvanic cells in which the following reactions take place:
(i) 2Cr(s) + 3Cd2+(aq) → 2Cr3+(aq) + 3Cd
(ii) Fe2+(aq) + Ag+(aq) → Fe3+(aq) + Ag(s)
Calculate the ΔrGø¸ and equilibrium constant of the reactions.
Write the Nernst equation and emf of the following cells at 298 K:
(i) Mg(s) | Mg2+(0.001M) || Cu2+(0.0001 M) | Cu(s)
(ii) Fe(s) | Fe2+(0.001M) || H+(1M)|H2(g)(1bar) | Pt(s)
(iii) Sn(s) | Sn2+(0.050 M) || H+(0.020 M) | H2(g) (1 bar) | Pt(s)
(iv) Pt(s) | Br2(l) | Br-(0.010 M) || H+(0.030 M) | H2(g) (1 bar) | Pt(s).
Define conductivity and molar conductivity for the solution of an electrolyte. Discuss their variation with concentration.
How would you determine the standard electrode potential of the system Mg2+ | Mg?
Predict the products of electrolysis in each of the following:
(i) An aqueous solution of AgNO3 with silver electrodes.
(ii) An aqueous solution of AgNO3with platinum electrodes.
(iii) A dilute solution of H2SO4with platinum electrodes.
(iv) An aqueous solution of CuCl2 with platinum electrodes.
A solution of Ni(NO3)2 is electrolysed between platinum electrodes using a current of 5 amperes for 20 minutes. What mass of Ni is deposited at the cathode?
The resistance of a conductivity cell containing 0.001M KCl solution at 298 K is 1500 Ω. What is the cell constant if conductivity of 0.001M KCl solution at 298 K is 0.146 x 10-3 S cm-1.
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Name two poisonous gases which can be prepared from chlorine gas.
Amongst the following, the most stable complex is
(i) [Fe(H2O)6]3+
(ii) [Fe(NH3)6]3+
(iii) [Fe(C2O4)3]3-
(iv) [FeCl6]3-
Why is N2 less reactive at room temperature?
Write the equations for the preparation of 1-iodobutane from
(i) 1-butanol
(ii) 1-chlorobutane
(iii) but-1-ene.
Enumerate the reactions of D-glucose which cannot be explained by its open chain structure.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Give the resonating structures of NO2 and N2O5.
What happens when
(i) n-butyl chloride is treated with alcoholic KOH,
(ii) bromobenzene is treated with Mg in the presence of dry ether,
(iii) chlorobenzene is subjected to hydrolysis,
(iv) ethyl chloride is treated with aqueous KOH,
(v) methyl bromide is treated with sodium in the presence of dry ether,
(vi) methyl chloride is treated with KCN.
Write the structure of the major organic product in each of the following reactions:
Which alkyl halide from the following pairs would you expect to react more rapidly by an SN2 mechanism? Explain your answer.