Class 12 Chemistry - Chapter Electrochemistry NCERT Solutions | Arrange the following metals in the orde

If a current of 0.5 ampere flows through a metallic wire for 2 hours, then how many electrons would flow through the wire?

Calculate the emf of the cell in which the following reaction takes place:

Ni_(s) + 2Ag⁺ (0.002 M) → Ni²⁺ (0.160 M) + 2Ag_(s)

Given that E^ø_cell = 1.05 V

Depict the galvanic cell in which the reaction Zn(s) + 2Ag⁺(aq) → Zn²⁺(aq) + 2Ag(s) takes place.

Further show:

(i) Which of the electrode is negatively charged?

(ii) The carriers of the current in the cell.

(iii) Individual reaction at each electrode.

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.

Write the Nernst equation and emf of the following cells at 298 K:

(i) Mg(s) | Mg²⁺(0.001M) || Cu²⁺(0.0001 M) | Cu(s)

(ii) Fe(s) | Fe²⁺(0.001M) || H⁺(1M)|H₂(g)(1bar) | Pt(s)

(iii) Sn(s) | Sn²⁺(0.050 M) || H⁺(0.020 M) | H₂(g) (1 bar) | Pt(s)

(iv) Pt(s) | Br₂(l) | Br^-(0.010 M) || H⁺(0.030 M) | H₂(g) (1 bar) | Pt(s).

Define conductivity and molar conductivity for the solution of an electrolyte. Discuss their variation with concentration.

How would you determine the standard electrode potential of the system Mg²⁺ | Mg?

Predict the products of electrolysis in each of the following:

(i) An aqueous solution of AgNO₃ with silver electrodes.

(ii) An aqueous solution of AgNO₃with platinum electrodes.

(iii) A dilute solution of H₂SO₄with platinum electrodes.

(iv) An aqueous solution of CuCl₂ with platinum electrodes.

A solution of Ni(NO₃)₂ is electrolysed between platinum electrodes using a current of 5 amperes for 20 minutes. What mass of Ni is deposited at the cathode?

The resistance of a conductivity cell containing 0.001M KCl solution at 298 K is 1500 Ω. What is the cell constant if conductivity of 0.001M KCl solution at 298 K is 0.146 x 10^-3 S cm^-1.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Why do solids have a definite volume?

What are the main constituents of dettol?

Explain the following terms with suitable examples:

(i) Schottky defect

(ii) Frenkel defect

(iii) Interstitials and

(iv) F-centres

What makes a glass different from a solid such as quartz? Under what conditions could quartz be converted into glass?

Gold (atomic radius = 0.144 nm) crystallises in a face-centred unit cell. What is the length of a side of the cell?

Calculate the osmotic pressure in pascals exerted by a solution prepared by dissolving 1.0 g of polymer of molar mass 185,000 in 450 mL of water at 37°C.

Explain the following with suitable examples:

(i) Ferromagnetism

(ii)Paramagnetism

(iii)Ferrimagnetism

(iv)Antiferromagnetism

(v)12-16 and 13-15 group compounds.

H₂S, a toxic gas with rotten egg like smell, is used for the qualitative analysis. If the solubility of H₂S in water at STP is 0.195 m, calculate Henry's law constant.

'Stability of a crystal is reflected in themagnitude of its melting point'. Comment. Collect melting points of solid water, ethyl alcohol, diethyl ether and methane from a data book. What can you say about the intermolecular forces between these molecules?