Class 12 Chemistry - Chapter Coordination Compounds NCERT Solutions | Using IUPAC norms write the systematic n

[NiCl₄]^2- is paramagnetic while [Ni(CO)₄] is diamagnetic though both are tetrahedral. Why?

Explain on the basis of valence bond theory that [Ni(CN)₄]^2- ion with square planar structure is diamagnetic and the [Ni(CN)₄]^2- ion with tetrahedral geometry is paramagnetic.

Draw figure to show the splitting of d orbitals in an octahedral crystal field.

Write down the IUPAC name for each of the following complexes and indicate the oxidation state, electronic configuration and coordination number. Also give stereochemistry and magnetic moment of the complex:

(i) K[Cr(H₂O)₂(C₂O₄)₂].3H₂O

(ii) [Co(NH₃)₅Cl]Cl₂

(iii) CrCl₃(py)₃

(iv) Cs[FeCl₄]

(v) K₄[Mn(CN)₆]

[Cr(NH₃)₆]³⁺ is paramagnetic while [Ni(CN)₄]^2- is diamagnetic.  Explain why?

The oxidation number of cobalt in K[Co(CO)₄] is

(i) +1

(ii) +3

(iii) -1

(iv) -3

Discuss the nature of bonding in metal carbonyls.

Discuss the nature of bonding in the following coordination entities on the basis of valence bond theory:

(i) [Fe(CN)₆]^4-

(ii) [FeF₆]^3-

(iii) [Co(C₂O₄)3]^3-

(iv) [CoF₆]^3-

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

Predict the number of unpaired electrons in the square planar [Pt(CN)₄]^2- ion.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Write chemical reaction of aniline with benzoyl chloride and write the name of the product obtained.

Write chemical reaction for the preparation of phenol from chlorobenzene.

Identify allylic alcohols in the above examples.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

You are given benzene, conc. H₂SO₄ and NaOH. Write the equations for the preparation of phenol using these reagents.

How is 'cast iron' different from 'pig iron"?

Classify the following amines as primary, secondary or tertiary:

(i)

(ii)

(iii) (C₂H₅)₂CHNH₂

(iv) (C₂H₅)₂NH

While separating a mixture of ortho and para nitrophenols by steam distillation, name the isomer which will be steam volatile. Give reason.

Name the parameters that characterize a unit cell.

Explain:   (i) Zone refining    (ii) Column chromatography.