Class 12 Chemistry - Chapter Chemistry in Everyday Life NCERT Solutions | If water contains dissolved calcium hydr

Why do soaps not work in hard water?

Explain the following terms with suitable examples

(i) cationic detergents

(ii) anionic detergents and

(iii) non-ionic detergents.

What are food preservatives ?

Sleeping pills are recommended by doctors to the patients suffering from sleeplessness but it is not advisable to take its doses without consultation with the doctor, Why?

How do antiseptics differ from disinfectants ? Give one example of each. 

Why is use of aspartame limited to cold foods and drinks?

What are the main constituents of dettol?

With reference to which classification has the statement, ranitidine is an antacid been given?

Write the chemical equation for preparing sodium soap from glyceryl oleate and glyceryl palmitate. Structural formulae of these compounds are given below.

(i) (C₁₅H₃₁COO)₃ C₃H₅ - Glyceryl palmitate

(ii)(C₁₇H₃₃COO)₃ C₃H₅ - Glyceryl oleate

Name a substance which can be used as an antiseptic as well as disinfectant.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

How is ammonia manufactured industrially?

Conductivity of 0.00241 M acetic acid is 7.896 × 10 ^{- 5} S cm ^{- 1}. Calculate its molar conductivity and if A_m^º for acetic acid is 390.5 S cm² mol ^{- 1}, what is its dissociation constant?

Give the significance of a lattice point.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Define the following as related to proteins 

(i) Peptide linkage  (ii) Primary structure  (iii) Denaturation.

In the following pairs of halogen compounds, which compound undergoes faster S_N1 reaction?

Why does the reactivity of nitrogen differ from phosphorus?

Explain why

(i) the dipole moment of chlorobenzene is lower than that of cyclohexyl chloride?

(ii) alkyl halides, though polar, are immiscible with water?

(iii) Grignard reagents should be prepared under anhydrous conditions?

Explain the following terms with suitable examples:

(i) Schottky defect

(ii) Frenkel defect

(iii) Interstitials and

(iv) F-centres

Predict conditions under which Al might be expected to reduce MgO.