Class 12 Chemistry - Chapter Chemistry in Everyday Life NCERT Solutions | Define the term chemotherapy.

Why do soaps not work in hard water?

Explain the following terms with suitable examples

(i) cationic detergents

(ii) anionic detergents and

(iii) non-ionic detergents.

What are food preservatives ?

Sleeping pills are recommended by doctors to the patients suffering from sleeplessness but it is not advisable to take its doses without consultation with the doctor, Why?

How do antiseptics differ from disinfectants ? Give one example of each. 

Why is use of aspartame limited to cold foods and drinks?

With reference to which classification has the statement, ranitidine is an antacid been given?

What are the main constituents of dettol?

Write the chemical equation for preparing sodium soap from glyceryl oleate and glyceryl palmitate. Structural formulae of these compounds are given below.

(i) (C₁₅H₃₁COO)₃ C₃H₅ - Glyceryl palmitate

(ii)(C₁₇H₃₃COO)₃ C₃H₅ - Glyceryl oleate

What are artificial sweetening agents? Give two examples.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Discuss briefly giving an example in each case the role of coordination compounds in:

(i) biological system

(ii) medicinal chemistry

(iii) analytical chemistry

(iv) extraction/metallurgy of metals

Write structures of the compounds whose IUPAC names are as follows:

(i) 2-Methylbutan-2-ol

(ii) 1-Phenylpropan-2-ol

(iii) 3,5-Dimethylhexane -1, 3, 5-triol

(iv) 2,3 - Diethylphenol

(v) 1 - Ethoxypropane

(vi) 2-Ethoxy-3-methylpentane

(vii) Cyclohexylmethanol

(viii) 3-Cyclohexylpentan-3-ol

(ix) Cyclopent-3-en-1-ol

(x) 3-Chloromethylpentan-1-ol.

If the radius of the octachedral void is r and radius of the atoms in close packing is R, derive relation between r and R.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Calculate the mass of urea (NH₂CONH₂) required in making 2.5 kg of 0.25 molal aqueous solution.

In terms of band theory, what is the difference

(i) Between a conductor and an insulator

(ii) Between a conductor and a semiconductor

What are the different types of RNA found in the cell?

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Heptane and octane form an ideal solution. At 373 K, the vapour pressures of the two liquid components are 105.2 kPa and 46.8 kPa respectively. What will be the vapour pressure of a mixture of 26.0 g of heptane and 35 g of octane?

Non-stoichiometric cuprous oxide, Cu₂O can be prepared in laboratory. In this oxide, copper to oxygen ratio is slightly less than 2:1. Can you account for the fact that this substance is a p-type semiconductor?