The rate of a reaction quadruples when the temperature changes from 293 K to 313 K. Calculate the energy of activation of the reaction assuming that it does not change with temperature.
From Arrhenius equation, we obtain
Hence, the required energy of activation is 52.86 kJ mol - 1.
The half-life for radioactive decay of 14C is 5730 years. An archaeological artifact containing wood had only 80% of the 14C found in a living tree. Estimate the age of the sample.
For a first order reaction, show that time required for 99% completion is twice the time required for the completion of 90% of reaction.
A first order reaction takes 40 min for 30% decomposition. Calculate t1/2.
In a reaction, 2A → Products, the concentration of A decreases from 0.5 mol L-1 to 0.4 mol L-1 in 10 minutes. Calculate the rate during this interval?
The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?
During nuclear explosion, one of the products is 90Sr with half-life of 28.1 years. If 1μg of 90Sr was absorbed in the bones of a newly born baby instead of calcium, how much of it will remain after 10 years and 60 years if it is not lost metabolically.
Sucrose decomposes in acid solution into glucose and fructose according to the first order rate law, with t1/2 = 3.00 hours. What fraction of sample of sucrose remains after 8 hours?
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
The decomposition of A into product has value of k as 4.5 x 103 s-1 at 10°C and energy of activation 60 kJ mol-1. At what temperature would k be 1.5 x 104 s-1?
The following data were obtained during the first order thermal decomposition of SO2Cl2at a constant volume.
SO2Cl2(g) → SO2(g) + Cl2(g)
Experiment |
Time/s - 1 |
Total pressure/atm |
1 | 0 | 0.5 |
2 | 100 | 0.6 |
Calculate the rate of the reaction when total pressure is 0.65 atm.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
How do you explain the amphoteric behaviour of amino acids?
How is the variability in oxidation states of transition metals different from that of the non-transition metals? Illustrate with examples.
Explain the following terms with suitable examples
(i) cationic detergents
(ii) anionic detergents and
(iii) non-ionic detergents.
Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.
(i) Methanal (ii) 2-Methylpentanal
(iii) Benzaldehyde (iv) Benzophenone
(v) Cyclohexanone (vi) 1-Phenylpropanone
(vii) Phenylacetaldehyde (viii) Butan-1-ol
(ix) 2, 2-Dimethylbutanal
How is ammonia manufactured industrially?
A compound is formed by two elements M and N. The element N forms ccp and atoms of M occupy 1/3rd of tetrahedral voids. What is the formula of the compound?
Why is BiH3 the strongest reducing agent amongst all the hydrides of Group 15 elements?
Out of C and CO, which is a better reducing agent at 673 K?
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Give the IUPAC names of the following compounds:
(i) PhCH2CH2COOH (ii) (CH3)2C=CHCOOH
(iii) (iv)
Thanks....
Cool
those one who are confuse for the value 4k1/k2=.6021 ,they mustlearn mathematical operation over logerthimic
those one who are confusefor tha value 4k1/k2=.6021 ,they mustlearn mathematical operation over logerthimic
from where we get 4k1/k2=0.6021
From where we get 4k1/k2=0.6021
To making lazy all the students
Thankyou
From where did we get the value of 4k2/k1?
Tqs Sir