Class 12 Chemistry - Chapter Chemical Kinetics NCERT Solutions | The decomposition of A into product has

The half-life for radioactive decay of ¹⁴C is 5730 years. An archaeological artifact containing wood had only 80% of the ¹⁴C found in a living tree. Estimate the age of the sample.

For a first order reaction, show that time required for 99% completion is twice the time required for the completion of 90% of reaction.

The rate of a reaction quadruples when the temperature changes from 293 K to 313 K. Calculate the energy of activation of the reaction assuming that it does not change with temperature.

A first order reaction takes 40 min for 30% decomposition. Calculate t_1/2.

In a reaction, 2A → Products, the concentration of A decreases from 0.5 mol L^-1 to 0.4 mol L^-1 in 10 minutes. Calculate the rate during this interval?

The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?

During nuclear explosion, one of the products is ⁹⁰Sr with half-life of 28.1 years. If 1μg of ⁹⁰Sr was absorbed in the bones of a newly born baby instead of calcium, how much of it will remain after 10 years and 60 years if it is not lost metabolically.

Sucrose decomposes in acid solution into glucose and fructose according to the first order rate law, with t_1/2 = 3.00 hours. What fraction of sample of sucrose remains after 8 hours?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

The following data were obtained during the first order thermal decomposition of SO₂Cl₂at a constant volume.

SO₂Cl₂₍g)  →  SO₂₍g) + Cl₂(g)

Calculate the rate of the reaction when total pressure is 0.65 atm.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

How is ammonia manufactured industrially?

Out of C and CO, which is a better reducing agent at 673 K?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Give the IUPAC names of the following compounds:

(i) PhCH₂CH₂COOH         (ii) (CH₃)₂C=CHCOOH

(iii)             (iv)

How will you prepare the following compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom

(i) Methyl benzoate             (ii) m-Nitrobenzoic acid

(iii) p-Nitrobenzoic acid        (iv) Phenylacetic acid

(v) p-Nitrobenzaldehyde.

Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.

(i) Methanal                       (ii) 2-Methylpentanal

(iii) Benzaldehyde              (iv) Benzophenone

(v) Cyclohexanone             (vi) 1-Phenylpropanone

(vii) Phenylacetaldehyde     (viii) Butan-1-ol

(ix) 2, 2-Dimethylbutanal

Why is helium used in diving apparatus?

An organic compound contains 69.77% carbon, 11.63% hydrogen and rest oxygen. The molecular mass of the compound is 86. It does not reduce Tollens' reagent but forms an addition compound with sodium hydrogensulphite and give positive iodoform test. On vigorous oxidation it gives ethanoic and propanoic acid. Write the possible structure of the compound.

An organic compound with the molecular formula C₉H₁₀O forms 2, 4-DNP derivative, reduces Tollens' reagent and undergoes Cannizzaro reaction. On vigorous oxidation, it gives 1, 2-benzenedicarboxylic acid. Identify the compound.

What are essential and non-essential amino acids? Give two examples ofeach type.