Class 12 Chemistry - Chapter Chemical Kinetics NCERT Solutions | What is the effect of temperature on the

The half-life for radioactive decay of ¹⁴C is 5730 years. An archaeological artifact containing wood had only 80% of the ¹⁴C found in a living tree. Estimate the age of the sample.

For a first order reaction, show that time required for 99% completion is twice the time required for the completion of 90% of reaction.

The rate of a reaction quadruples when the temperature changes from 293 K to 313 K. Calculate the energy of activation of the reaction assuming that it does not change with temperature.

A first order reaction takes 40 min for 30% decomposition. Calculate t_1/2.

In a reaction, 2A → Products, the concentration of A decreases from 0.5 mol L^-1 to 0.4 mol L^-1 in 10 minutes. Calculate the rate during this interval?

The conversion of molecules X to Y follows second order kinetics. If concentration of X is increased to three times how will it affect the rate of formation of Y?

During nuclear explosion, one of the products is ⁹⁰Sr with half-life of 28.1 years. If 1μg of ⁹⁰Sr was absorbed in the bones of a newly born baby instead of calcium, how much of it will remain after 10 years and 60 years if it is not lost metabolically.

Sucrose decomposes in acid solution into glucose and fructose according to the first order rate law, with t_1/2 = 3.00 hours. What fraction of sample of sucrose remains after 8 hours?

The decomposition of A into product has value of k as 4.5 x 10³ s^-1 at 10°C and energy of activation 60 kJ mol^-1. At what temperature would k be 1.5 x 10⁴ s^-1?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Write the names of reagents and equations for the preparation of the following ethers by Williamson's synthesis:

(i) 1-Propoxypropane

(ii) Ethoxybenzene

(iii) 2-Methoxy-2-methylpropane

(iv) 1-Methoxyethane

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Define the term chemotherapy.

Discuss briefly giving an example in each case the role of coordination compounds in:

(i) biological system

(ii) medicinal chemistry

(iii) analytical chemistry

(iv) extraction/metallurgy of metals

Write structures of the compounds whose IUPAC names are as follows:

(i) 2-Methylbutan-2-ol

(ii) 1-Phenylpropan-2-ol

(iii) 3,5-Dimethylhexane -1, 3, 5-triol

(iv) 2,3 - Diethylphenol

(v) 1 - Ethoxypropane

(vi) 2-Ethoxy-3-methylpentane

(vii) Cyclohexylmethanol

(viii) 3-Cyclohexylpentan-3-ol

(ix) Cyclopent-3-en-1-ol

(x) 3-Chloromethylpentan-1-ol.

If the radius of the octachedral void is r and radius of the atoms in close packing is R, derive relation between r and R.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Calculate the mass of urea (NH₂CONH₂) required in making 2.5 kg of 0.25 molal aqueous solution.

In terms of band theory, what is the difference

(i) Between a conductor and an insulator

(ii) Between a conductor and a semiconductor

What are the different types of RNA found in the cell?