Class 12 Chemistry - Chapter Biomolecules NCERT Solutions | What are the expected products of hydrol

What happens when D-glucose is treated with the following reagents? (i)HI (ii)Bromine water (iii)HNO₃

How do you explain the absence of aldehyde group in the pentaacetate of D-glucose?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

The melting points and solubility in water of amino acids are generally higher than that of the corresponding halo acids. Explain.

Define the following as related to proteins 

(i) Peptide linkage  (ii) Primary structure  (iii) Denaturation.

What products would be formed when a nucleotide from DNA containing thymine is hydrolysed?

Enumerate the reactions of D-glucose which cannot be explained by its open chain structure.

What are nucleic acids? Mention their two important functions.

The two strands in DNA are not identical but are complementary. Explain.

Where does the water present in the egg go after boiling the egg?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Vapour pressure of water at 293 Kis 17.535 mm Hg. Calculate the vapour pressure of water at 293 Kwhen 25 g of glucose is dissolved in 450 g of water.

What is the effect of temperature on the rate constant of a reaction? How can this temperature effect on rate constant be represented quantitatively?

Write the names of reagents and equations for the preparation of the following ethers by Williamson's synthesis:

(i) 1-Propoxypropane

(ii) Ethoxybenzene

(iii) 2-Methoxy-2-methylpropane

(iv) 1-Methoxyethane

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Define the term chemotherapy.

Discuss briefly giving an example in each case the role of coordination compounds in:

(i) biological system

(ii) medicinal chemistry

(iii) analytical chemistry

(iv) extraction/metallurgy of metals

Write structures of the compounds whose IUPAC names are as follows:

(i) 2-Methylbutan-2-ol

(ii) 1-Phenylpropan-2-ol

(iii) 3,5-Dimethylhexane -1, 3, 5-triol

(iv) 2,3 - Diethylphenol

(v) 1 - Ethoxypropane

(vi) 2-Ethoxy-3-methylpentane

(vii) Cyclohexylmethanol

(viii) 3-Cyclohexylpentan-3-ol

(ix) Cyclopent-3-en-1-ol

(x) 3-Chloromethylpentan-1-ol.

If the radius of the octachedral void is r and radius of the atoms in close packing is R, derive relation between r and R.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Calculate the mass of urea (NH₂CONH₂) required in making 2.5 kg of 0.25 molal aqueous solution.