Class 12 Chemistry - Chapter Biomolecules NCERT Solutions | How do you explain the amphoteric behavi

What happens when D-glucose is treated with the following reagents? (i)HI (ii)Bromine water (iii)HNO₃

How do you explain the absence of aldehyde group in the pentaacetate of D-glucose?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

The melting points and solubility in water of amino acids are generally higher than that of the corresponding halo acids. Explain.

Define the following as related to proteins 

(i) Peptide linkage  (ii) Primary structure  (iii) Denaturation.

What products would be formed when a nucleotide from DNA containing thymine is hydrolysed?

The two strands in DNA are not identical but are complementary. Explain.

Enumerate the reactions of D-glucose which cannot be explained by its open chain structure.

What are nucleic acids? Mention their two important functions.

Where does the water present in the egg go after boiling the egg?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

The reaction,

      Cr₂O₃  +  2Al    →    Al₂O₃  + 2Cr            (ΔG_o = -421kJ)

is thermodynamically feasible as is apparent from the Gibbs energy value. Why does it not take place at room temperature?

Using IUPAC norms write the systematic names of the following:

(i) [Co(NH₃)6]Cl₃

(ii) [Pt(NH₃)₂Cl(NH₂CH₃)]Cl

(iii) [Ti(H₂O)6]³⁺

(iv) [Co(NH₃)₄Cl(NO₂)]Cl

(v) [Mn(H₂O)6]²⁺

(vi) [NiCl₄]^2-

(vii) [Ni(NH₃)₆]Cl₂

(viii) [Co(en)₃]³⁺

(ix) [Ni(CO)₄]

Accomplish the following conversions:

(i) Nitrobenzene to benzoic acid

(ii) Benzene to m-bromophenol

(iii) Benzoic acid to aniline

(iv) Aniline to 2,4,6-tribromofluorobenzene

(v) Benzyl chloride to 2-phenylethanamine

(vi) Chlorobenzene to p-chloroaniline

(vii) Aniline to p-bromoaniline

(viii) Benzamide to toluene

(ix) Aniline to benzyl alcohol.

Write equations of the following reactions:

(i) Friedel-Crafts reaction-alkylation of anisole.

(ii) Nitration of anisole.

(iii) Bromination of anisole in ethanoic acid medium.

(iv) Friedel-Craft's acetylation of anisole.

A reaction is second order with respect to a reactant. How is the rate of reaction affected if the concentration of the reactant is

(i) doubled

(ii) reduced to half?

Mention the conditions required to maximise the yield of ammonia.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Write the mechanism of hydration of ethene to yield ethanol.

The rate constant for the decomposition of hydrocarbons is 2.418 x 10^-5 s^-1 at 546 K. If the energy of activation is 179.9 kJ/mol, what will be the value of pre-exponential factor.

Describe some features of catalysis by zeolites.