Class 12 Chemistry - Chapter Biomolecules NCERT Solutions | What are reducing sugars?

What happens when D-glucose is treated with the following reagents? (i)HI (ii)Bromine water (iii)HNO₃

How do you explain the absence of aldehyde group in the pentaacetate of D-glucose?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

The melting points and solubility in water of amino acids are generally higher than that of the corresponding halo acids. Explain.

Define the following as related to proteins 

(i) Peptide linkage  (ii) Primary structure  (iii) Denaturation.

What products would be formed when a nucleotide from DNA containing thymine is hydrolysed?

The two strands in DNA are not identical but are complementary. Explain.

Enumerate the reactions of D-glucose which cannot be explained by its open chain structure.

What are nucleic acids? Mention their two important functions.

Where does the water present in the egg go after boiling the egg?

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Identify the monomer in the following polymeric structures.

(i)

(ii)

Which of the following is an appropriate set of reactants for the preparation of 1-methoxy-4-nitrobenzene and why?

Alcohols are comparatively more soluble in water than hydrocarbons of comparable molecular masses. Explain this fact.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Two elements A and B form compounds having formula AB₂ and AB₄. When dissolved in 20 g of benzene (C₆H₆), 1 g of AB₂ lowers the freezing point by 2.3 Kwhereas 1.0 g of AB₄ lowers it by 1.3 K. The molar depression constant for benzene is 5.1 Kkg mol^-1. Calculate atomic masses of A and B.

Which of the 3d series of the transition metals exhibits the largest number of oxidation states and why?

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

What are the monomeric repeating units of Nylon-6 and Nylon-6, 6?

How will you distinguish between the following pairs of terms:

(i) Hexagonal close-packing and cubic close-packing?

(ii) Crystal lattice and unit cell?

(iii) Tetrahedral void and octahedral void?

Give the formula and describe the structure of a noble gas species which is isostructural with:

(i) ICl^-₄

(ii) IBr^-₂

(iii) BrO^-₃