Class 12 Chemistry - Chapter Amines NCERT Solutions | Write the reactions of (i) aromatic and

Arrange the following in increasing order of their basic strength:

(i) C₂H₅NH₂, C₆H₅NH₂, NH₃, C₆H₅CH₂NH₂ and (C₂H₅)₂NH

(ii) C₂H₅NH₂, (C₂H₅)₂NH, (C₂H₅)₃N, C₆H₅NH₂

(iii) CH₃NH₂, (CH₃)₂NH, (CH₃)₃N, C₆H₅NH₂, C₆H₅CH₂NH₂.

How will you convert?

(i) Benzene into aniline

(ii) Benzene into N, N-dimethylaniline

(iii) Cl-(CH₂)₄-Cl into hexan-1, 6-diamine?

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Arrange the following:

(i) In decreasing order of the pK_bvalues:

C₂H₅NH₂, C₆H₅NHCH₃, (C₂H₅)₂NH and C₆H₅NH₂

(ii) In increasing order of basic strength:

C₆H₅NH₂, C₆H₅N(CH₃)₂, (C₂H₅)₂NH and CH₃NH₂

(iii) In increasing order of basic strength:

(a) Aniline, p-nitroaniline and p-toluidine

(b) C₆H₅NH₂, C₆H₅NHCH₃, C₆H₅CH₂NH₂.

(iv) In decreasing order of basic strength in gas phase:

C₂H₅NH₂, (C₂H₅)₂NH, (C₂H₅)₃N and NH₃

(v) In increasing order of boiling point:

C₂H₅OH, (CH₃)₂NH, C₂H₅NH₂

(vi) In increasing order of solubility in water:

C₆H₅NH₂, (C₂H₅)₂NH, C₂H₅NH₂.

Convert

(i) 3-Methylaniline into 3-nitrotoluene.

(ii) Aniline into 1,3,5-tribromobenzene.

Write reactions of the final alkylation product of aniline with excess of methyl iodide in the presence of sodium carbonate solution.

Write short notes on the following:

(i) Carbylamine reaction (ii) Diazotisation

(iii) Hofmann's bromamide reaction (iv) Coupling reaction

(v) Ammonolysis (vi) Acetylation

(vii) Gabriel phthalimide synthesis.

How will you convert:

(i) Ethanoic acid into methanamine

(ii) Hexanenitrile into 1-aminopentane

(iii) Methanol to ethanoic acid

(iv) Ethanamine into methanamine

(v) Ethanoic acid into propanoic acid

(vi) Methanamine into ethanamine

(vii) Nitromethane into dimethylamine

(viii) Propanoic acid into ethanoic acid

An aromatic compound 'A' on treatment with aqueous ammonia and heating forms compound 'B' which on heating with Br2 and KOH forms a compound 'C' of molecular formula C6H7N. Write the structures and IUPAC names of compounds A, B and C.

Accomplish the following conversions:

(i) Nitrobenzene to benzoic acid

(ii) Benzene to m-bromophenol

(iii) Benzoic acid to aniline

(iv) Aniline to 2,4,6-tribromofluorobenzene

(v) Benzyl chloride to 2-phenylethanamine

(vi) Chlorobenzene to p-chloroaniline

(vii) Aniline to p-bromoaniline

(viii) Benzamide to toluene

(ix) Aniline to benzyl alcohol.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Write structures of the following compounds:

(i) 2-Chloro-3-methylpentane

(ii) 1-Chloro-4-ethylcyclohexane

(iii) 4-tert. Butyl-3-iodoheptane

(iv) 1,4-Dibromobut-2-ene

(v) 1-Bromo-4-sec. butyl-2-methylbenzene

Distinguish between the terms homopolymer and copolymer and give an example of each.

Write the reactions of F₂ and Cl₂ with water.

Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?

How is leaching carried out in case of low grade copper ores?

The activation energy for the reaction 2HI_(g) → H₂ + I_2(g) is 209.5 kJ mol^-1 at 581 K. Calculate the fraction of molecules of reactants having energy equal to or greater than activation energy?

Explain [Co(NH₃)₆]³⁺ is an inner orbital complex whereas [Ni(NH₃)₆]²⁺ is an outer orbital complex.

Write the structures of products of the following reactions;

(i)

(ii)

(iii)

(iv)

Give four examples of heterogeneous catalysis.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide