Describe a method for the identification of primary, secondary and tertiary amines. Also write chemical equations of the reactions involved.
Primary, secondary and tertiary amines can be identified and distinguished by Hinsberg's test. In this test, the amines are allowed to react with Hinsberg's reagent, benzenesulphonyl chloride (C6H5SO2Cl). The three types of amines react differently with Hinsberg's reagent. Therefore, they can be easily identified using Hinsberg's reagent.
Primary amines react with benzenesulphonyl chloride to form N-alkylbenzenesulphonyl amide which is soluble in alkali.
Due to the presence of a strong electron-withdrawing sulphonyl group in the sulphonamide, the H-atom attached to nitrogen can be easily released as proton. So, it is acidic and dissolves in alkali.
Secondary amines react with Hinsberg's reagent to give a sulphonamide which is insoluble in alkali.
There is no H-atom attached to the N-atom in the sulphonamide. Therefore, it is not acidic and insoluble in alkali.
On the other hand, tertiary amines do not react with Hinsberg's reagent at all.
Arrange the following in increasing order of their basic strength:
(i) C2H5NH2, C6H5NH2, NH3, C6H5CH2NH2 and (C2H5)2NH
(ii) C2H5NH2, (C2H5)2NH, (C2H5)3N, C6H5NH2
(iii) CH3NH2, (CH3)2NH, (CH3)3N, C6H5NH2, C6H5CH2NH2.
How will you convert?
(i) Benzene into aniline
(ii) Benzene into N, N-dimethylaniline
(iii) Cl-(CH2)4-Cl into hexan-1, 6-diamine?
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Arrange the following:
(i) In decreasing order of the pKbvalues:
C2H5NH2, C6H5NHCH3, (C2H5)2NH and C6H5NH2
(ii) In increasing order of basic strength:
C6H5NH2, C6H5N(CH3)2, (C2H5)2NH and CH3NH2
(iii) In increasing order of basic strength:
(a) Aniline, p-nitroaniline and p-toluidine
(b) C6H5NH2, C6H5NHCH3, C6H5CH2NH2.
(iv) In decreasing order of basic strength in gas phase:
C2H5NH2, (C2H5)2NH, (C2H5)3N and NH3
(v) In increasing order of boiling point:
C2H5OH, (CH3)2NH, C2H5NH2
(vi) In increasing order of solubility in water:
C6H5NH2, (C2H5)2NH, C2H5NH2.
Convert
(i) 3-Methylaniline into 3-nitrotoluene.
(ii) Aniline into 1,3,5-tribromobenzene.
Write reactions of the final alkylation product of aniline with excess of methyl iodide in the presence of sodium carbonate solution.
Write short notes on the following:
(i) Carbylamine reaction (ii) Diazotisation
(iii) Hofmann's bromamide reaction (iv) Coupling reaction
(v) Ammonolysis (vi) Acetylation
(vii) Gabriel phthalimide synthesis.
How will you convert:
(i) Ethanoic acid into methanamine
(ii) Hexanenitrile into 1-aminopentane
(iii) Methanol to ethanoic acid
(iv) Ethanamine into methanamine
(v) Ethanoic acid into propanoic acid
(vi) Methanamine into ethanamine
(vii) Nitromethane into dimethylamine
(viii) Propanoic acid into ethanoic acid
An aromatic compound 'A' on treatment with aqueous ammonia and heating forms compound 'B' which on heating with Br2 and KOH forms a compound 'C' of molecular formula C6H7N. Write the structures and IUPAC names of compounds A, B and C.
Accomplish the following conversions:
(i) Nitrobenzene to benzoic acid
(ii) Benzene to m-bromophenol
(iii) Benzoic acid to aniline
(iv) Aniline to 2,4,6-tribromofluorobenzene
(v) Benzyl chloride to 2-phenylethanamine
(vi) Chlorobenzene to p-chloroaniline
(vii) Aniline to p-bromoaniline
(viii) Benzamide to toluene
(ix) Aniline to benzyl alcohol.
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
Why are solids rigid?
Write any two characteristics of Chemisorption.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
What are polymers?
Explain the difference between Buna-N and Buna-S.
What are monosaccharides?
Discuss the general characteristics of Group 15 elements with reference to their electronic configuration, oxidation state, atomic size, ionisation enthalpy and electronegativity.
Write the reactions of F2 and Cl2 with water.
Explain the terms polymer and monomer.
Define the term polymerisation.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
Write balanced equations for the following:
(i) NaCl is heated with sulphuric acid in the presence of MnO2.
(ii) Chlorine gas is passed into a solution of NaI in water.
Write all the geometrical isomers of [Pt(NH3)(Br)(Cl)(py)] and how many of these will exhibit optical isomers?
Short language sir