Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
(i) 4-methylpentanal
(ii) 6-Chloro-4-ethylhexan-3-one
(iii) But-2-en-1-al
(iv) Pentane-2,4-dione
(v) 3,3,5-Trimethylhexan-2-one
(vi) 3,3-Dimethylbutanoic acid
(vii) Benzene-1,4-dicarbaldehyde
Give simple chemical tests to distinguish between the following pairs of compounds.
(i) Propanal and Propanone
(ii) Acetophenone and Benzophenone
(iii) Phenol and Benzoic acid
(iv) Benzoic acid and Ethyl benzoate
(v) Pentan-2-one and Pentan-3-one
(vi) Benzaldehyde and Acetophenone
(vii) Ethanal and Propanal
Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.
(i) Methanal (ii) 2-Methylpentanal
(iii) Benzaldehyde (iv) Benzophenone
(v) Cyclohexanone (vi) 1-Phenylpropanone
(vii) Phenylacetaldehyde (viii) Butan-1-ol
(ix) 2, 2-Dimethylbutanal
How will you convert ethanal into the following compounds?
(i) Butane-1, 3-diol (ii) But-2-enal (iii) But-2-enoic acid
Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.
(i)Ethanal, Propanal, Propanone, Butanone.
(ii)Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.
Hint:Consider steric effect and electronic effect.
Write the structures of the following compounds.
(i) α-Methoxypropionaldehyde
(ii) 3-Hydroxybutanal
(iii) 2-Hydroxycyclopentane carbaldehyde
(iv) 4-Oxopentanal
(v) Di-sec-butyl ketone
(vi) 4-Fluoroacetophenone
Arrange the following compounds in increasing order of their property as indicated:
(i) Acetaldehyde, Acetone, Di-tert-butyl ketone, Methyl tert-butyl ketone (reactivity towards HCN)
(ii) CH3CH2CH(Br)COOH, CH3CH(Br)CH2COOH, (CH3)2CHCOOH, CH3CH2CH2COOH (acid strength)
(iii) Benzoic acid, 4-Nitrobenzoic acid, 3,4-Dinitrobenzoic acid, 4-Methoxybenzoic acid (acid strength)
Describe the following:
(i) Acetylation
(ii) Cannizzaro reaction
(iii) Cross aldol condensation
(iv) Decarboxylation
Give plausible explanation for each of the following:
(i) Cyclohexanone forms cyanohydrin in good yield but 2, 2, 6 trimethylcyclohexanone does not.
(ii) There are two -NH2 groups in semicarbazide. However, only one is involved in the formation of semicarbazones.
(iii) During the preparation of esters from a carboxylic acid and an alcohol in the presence of an acid catalyst, the water or the ester should be removed as soon as it is formed.
Which acid of each pair shown here would you expect to be stronger?
(i) CH3CO2H or CH2FCO2H
(ii)CH2FCO2H or CH2ClCO2H
(iii) CH2FCH2CH2CO2H or CH3CHFCH2CO2H
(iv)
Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
(i) PhMgBr and then H3O+
(ii)Tollens' reagent
(iii) Semicarbazide and weak acid
(iv)Excess ethanol and acid
(v) Zinc amalgam and dilute hydrochloric acid
For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.
Write the formulas for the following coordination compounds:
(i) Tetraamminediaquacobalt (III) chloride
(ii) Potassium tetracyanonickelate(II)
(iii) Tris(ethane-1,2-diamine) chromium(III) chloride
(iv) Amminebromidochloridonitrito-N-platinate(II)
(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate
(vi) Iron(III) hexacyanoferrate(II)
(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N
(ii) Write IUPAC names of all the isomers.
(iii) What type of isomerism is exhibited by different pairs of amines?
Why are solids rigid?
Write any two characteristics of Chemisorption.
Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?
Why are pentahalides more covalent than trihalides?
Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?
Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.
Write structures of the following compounds:
(i) 2-Chloro-3-methylpentane
(ii) 1-Chloro-4-ethylcyclohexane
(iii) 4-tert. Butyl-3-iodoheptane
(iv) 1,4-Dibromobut-2-ene
(v) 1-Bromo-4-sec. butyl-2-methylbenzene
Predict the products of electrolysis in each of the following:
(i) An aqueous solution of AgNO3 with silver electrodes.
(ii) An aqueous solution of AgNO3with platinum electrodes.
(iii) A dilute solution of H2SO4with platinum electrodes.
(iv) An aqueous solution of CuCl2 with platinum electrodes.
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
Classify the following as addition and condensation polymers: Terylene, Bakelite, Polyvinyl chloride, Polythene.
What is the coordination entity formed when excess of aqueous KCN is added to an aqueous solution of copper sulphate? Why is it that no precipitate of copper sulphide is obtained when H2S(g) is passed through this solution?
The time required for 10% completion of a first order reaction at 298 K is equal to that required for its 25% completion at 308 K. If the value of A is 4 x 1010 s-1. Calculate k at 318 K and Ea.
The conductivity of 0.20 M solution of KCl at 298 K is 0.0248 Scm-1. Calculate its molar conductivity.
The decomposition of NH3on platinum surface is zero order reaction. What are the rates of production of N2and H2if k = 2.5 x 10-4mol-1L s-1?
Give the disproportionation reaction of H3PO3.
Calculate the 'spin only' magnetic moment of M2+(aq) ion (Z = 27).
The oxidation number of cobalt in K[Co(CO)4] is
(i) +1
(ii) +3
(iii) -1
(iv) -3
nice work sarah