Class 12 Chemistry - Chapter Alcohols Phenols and Ethers NCERT Solutions | (i) Draw the structures of all isomeric

Explain the following with an example.

(i) Kolbe's reaction.

(ii) Reimer-Tiemann reaction.

(iii) Williamson ether synthesis.

(iv) Unsymmetrical ether.

How are the following conversions carried out?

(i) Propene → Propan-2-ol

(ii) Benzyl chloride → Benzyl alcohol

(iii) Ethyl magnesium chloride → Propan-1-ol.

(iv) Methyl magnesium bromide → 2-Methylpropan-2-ol.

Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.

Give the equations of reactions for the preparation of phenol from cumene.

Write equations of the following reactions:

(i) Friedel-Crafts reaction-alkylation of anisole.

(ii) Nitration of anisole.

(iii) Bromination of anisole in ethanoic acid medium.

(iv) Friedel-Craft's acetylation of anisole.

Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?

Show how are the following alcohols prepared by the reaction of a suitable

Grignard reagent on methanal?

(i)

(ii)

Give two reactions that show the acidic nature of phenol. Compare acidity of phenol with that of ethanol.

Write the reactions of Williamson synthesis of 2-ethoxy-3-methylpentane starting from ethanol and 3-methylpentan-2-ol.

What is meant by hydroboration-oxidation reaction? Illustrate it with an example.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

Solid A is a very hard electrical insulator in solid as well as in molten state and melts at extremely high temperature. What type of solid is it?

While antacids and anti allergic drugs interfere with the function of histamines, why do these not interfere with the function of each other ?

Calculate the standard cell potentials of galvanic cells in which the following reactions take place:

(i) 2Cr(s) + 3Cd²⁺(aq) → 2Cr³⁺(aq) + 3Cd

(ii) Fe²⁺(aq) + Ag+(aq) → Fe³⁺(aq) + Ag(s)

Calculate the ΔrG^ø¸ and equilibrium constant of the reactions.

Why is glass considered a super cooled liquid?

Name the oxometal anions of the first series of the transition metals in which the metal exhibits the oxidation state equal to its group number.

Comment on the nature of two S-O bonds formed in SO₂ molecule. Are the two S-O bonds in this molecule equal?

Explain why NH₃ is basic while BiH₃ is only feebly basic.

Why cannot aromatic primary amines be prepared by Gabriel phthalimide synthesis?

Write the reactions of (i) aromatic and (ii) aliphatic primary amines with nitrous acid.