Class 12 Chemistry - Chapter Alcohols Phenols and Ethers NCERT Solutions | Identify allylic alcohols in the above e

Explain the following with an example.

(i) Kolbe's reaction.

(ii) Reimer-Tiemann reaction.

(iii) Williamson ether synthesis.

(iv) Unsymmetrical ether.

How are the following conversions carried out?

(i) Propene → Propan-2-ol

(ii) Benzyl chloride → Benzyl alcohol

(iii) Ethyl magnesium chloride → Propan-1-ol.

(iv) Methyl magnesium bromide → 2-Methylpropan-2-ol.

Write the mechanism of acid-catalysed dehydration of ethanol to yield ethene.

Give the equations of reactions for the preparation of phenol from cumene.

Write equations of the following reactions:

(i) Friedel-Crafts reaction-alkylation of anisole.

(ii) Nitration of anisole.

(iii) Bromination of anisole in ethanoic acid medium.

(iv) Friedel-Craft's acetylation of anisole.

Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?

Show how are the following alcohols prepared by the reaction of a suitable

Grignard reagent on methanal?

(i)

(ii)

Give two reactions that show the acidic nature of phenol. Compare acidity of phenol with that of ethanol.

Write the reactions of Williamson synthesis of 2-ethoxy-3-methylpentane starting from ethanol and 3-methylpentan-2-ol.

What is meant by hydroboration-oxidation reaction? Illustrate it with an example.

For the reaction R → P, the concentration of a reactant changes from 0.03 M to 0.02 M in 25 minutes. Calculate the average rate of reaction using units of time both in minutes and seconds.

Write the formulas for the following coordination compounds:

(i) Tetraamminediaquacobalt (III) chloride

(ii) Potassium tetracyanonickelate(II)

(iii) Tris(ethane-1,2-diamine) chromium(III) chloride

(iv) Amminebromidochloridonitrito-N-platinate(II)

(v) Dichloridobis(ethane-1,2-diamine)platinum(IV) nitrate

(vi) Iron(III) hexacyanoferrate(II)

(i) Write structures of different isomeric amines corresponding to the molecular formula, C4H11N

(ii) Write IUPAC names of all the isomers.

(iii) What type of isomerism is exhibited by different pairs of amines?

Why are solids rigid?

Write any two characteristics of Chemisorption.

Write the structures of the following compounds.

(i) α-Methoxypropionaldehyde

(ii) 3-Hydroxybutanal

(iii) 2-Hydroxycyclopentane carbaldehyde

(iv) 4-Oxopentanal

(v) Di-sec-butyl ketone

(vi) 4-Fluoroacetophenone

Which of the ores mentioned in Table 6.1 can be concentrated by magnetic separation method?

Why are pentahalides more covalent than trihalides?

Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a transition element?

Glucose or sucrose are soluble in water but cyclohexane or benzene (simple six membered ring compounds) are insoluble in water. Explain.

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

How is 'cast iron' different from 'pig iron"?

Classify the following amines as primary, secondary or tertiary:

(i)

(ii)

(iii) (C₂H₅)₂CHNH₂

(iv) (C₂H₅)₂NH

Name the parameters that characterize a unit cell.

Explain:   (i) Zone refining    (ii) Column chromatography.

Which one of the following does not exist?

(i) XeOF₄

(ii) NeF₂

(iii) XeF₂

(iv) XeF₆

Explain briefly how +2 state becomes more and more stable in the first half of the first row transition elements with increasing atomic number?

What can be inferred from the magnetic moment values of the following complex species?

Example Magnetic Moment (BM)

K₄[Mn(CN)₆] 2.2

[Fe(H₂O)₆]²⁺ 5.3

K₂[MnCl₄] 5.9

If the density of some lake water is 1.25 g mL^-1 and contains 92 g of Na⁺ ions per kg of water, calculate the molality of Na⁺ ions in the lake.

Arrange the following metals in the order in which they displace each other from the solution of their salts.

Al, Cu, Fe, Mg and Zn