Using IUPAC norms write the formulae for the following:
(a) Potassium trioxalatoaluminate(III)
(b) Dichlorido bis (ethane- 1,2 -diamine) cobalt(II)
(a) Formulae of Potassium trioxalatoaluminate(III)
K3[Al(C2O4)]
(b) Formulae of Dichlorido bis (ethane- 1,2 -diamine) cobalt(II):
[COCl2(en)2]+
How the following conversions can be carried out?
(i) Propene to propan-1-ol
(ii) Ethanol to but-1-yne
(iii) 1-Bromopropane to 2-bromopropane
(iv) Toluene to benzyl alcohol
(v) Benzene to 4-bromonitrobenzene
(vi) Benzyl alcohol to 2-phenylethanoic acid
(vii) Ethanol to propanenitrile
(viii) Aniline to chlorobenzene
(ix) 2-Chlorobutane to 3, 4-dimethylhexane
(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane
(xi) Ethyl chloride to propanoic acid
(xii) But-1-ene to n-butyliodide
(xiii) 2-Chloropropane to 1-propanol
(xiv) Isopropyl alcohol to iodoform
(xv) Chlorobenzene to p-nitrophenol
(xvi) 2-Bromopropane to 1-bromopropane
(xvii) Chloroethane to butane
(xviii) Benzene to diphenyl
(xix) tert-Butyl bromide to isobutyl bromide
(xx) Aniline to phenylisocyanide
Give simple chemical tests to distinguish between the following pairs of compounds.
(i) Propanal and Propanone
(ii) Acetophenone and Benzophenone
(iii) Phenol and Benzoic acid
(iv) Benzoic acid and Ethyl benzoate
(v) Pentan-2-one and Pentan-3-one
(vi) Benzaldehyde and Acetophenone
(vii) Ethanal and Propanal
A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.
A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL-1, then what shall be the molarity of the solution?
Henry's law constant for CO2 in water is 1.67 x 108Pa at 298 K. Calculate the quantity of CO2in 500 mL of soda water when packed under 2.5 atm CO2 pressure at 298 K.
Calculate the mass of a non-volatile solute (molar mass 40 g mol-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.
The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.
Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.
How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na2CO3 and NaHCO3 containing equimolar amounts of both?
If NaCl is doped with 10-3mol % of SrCl2, what is the concentration of cation vacancies?
A compound forms hexagonal close-packed structure. What is the total number of voids in 0.5 mol of it? How many of these are tetrahedral voids?
100 g of liquid A (molar mass 140 g mol-1) was dissolved in 1000 g of liquid B (molar mass 180 g mol-1). The vapour pressure of pure liquid B was found to be 500 torr. Calculate the vapour pressure of pure liquid A and its vapour pressure in the solution if the total vapour pressure of the solution is 475 Torr.
Explain the term copolymerisation and give two examples.
Write chemical reaction for the preparation of phenol from chlorobenzene.
Given the standard electrode potentials,
K+/ K = - 2.93V,
Ag+/ Ag = 0.80V,
Hg2+ / Hg = 0.79V
Mg2+ / Mg = - 2.37 V,
Cr3+ / Cr = - 0.74V
Arrange these metals in their increasing order of reducing power.
Describe the oxidising action of potassium dichromate and write the ionicequations for its reaction with:
(i) iodide
(ii) iron
(II) solution and
(iii) H2S
Why are halogens coloured?
Calculate the potential of hydrogen electrode in contact with a solution whose pH is 10.
Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO
(ii) CH3CH2COCH(C2H5)CH2CH2Cl
(iii) CH3CH=CHCHO
(iv) CH3COCH2COCH3
(v) CH3CH(CH3)CH2C(CH3)2COCH3
(vi) (CH3)3CCH2COOH
(vii) OHCC6H4CHO-p
[Fe(CN)6]4- and [Fe(H2O)6]2+ are of different colours in dilute solutions. Why?